A3411512
2′,5′-Dichloroacetophenone , >98.0%(GC) , 2476-37-1
CAS NO.：2476-37-1
Empirical Formula: C8H6Cl2O
Molecular Weight: 189.04
MDL number: MFCD00000607
EINECS: 219-605-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.56 | In Stock |
|
| 25G | RMB58.64 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 500G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 11-13 °C(lit.) |
| Boiling point: | 118 °C (12 mmHg) |
| Density | 1.312 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.312 |
| color | Clear yellow to brownish |
| BRN | 1865043 |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=CC=C1Cl)C |
| CAS DataBase Reference | 2476-37-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Dichloroacetophenone(2476-37-1) |
| EPA Substance Registry System | Ethanone, 1-(2,5-dichlorophenyl)- (2476-37-1) |
Description and Uses
2′,5′-Dichloroacetophenone was used in the synthesis of 5-chloro-2-(2-thienylthio)acetophenone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 24/25-36-26-37-23 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29147000 |
