A3595712
3,5-Dibromo-2-methylthiophene , >95.0%(GC) , 29421-73-6
CAS NO.：29421-73-6
Empirical Formula: C5H4Br2S
Molecular Weight: 255.96
MDL number: MFCD07781197
EINECS: 249-617-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB110.40 | In Stock |
|
| 5G | RMB393.60 | In Stock |
|
| 25G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -15°C(lit.) |
| Boiling point: | 230°C(lit.) |
| Density | 2 |
| refractive index | 1.6120-1.6160 |
| storage temp. | 0-10°C |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C5H4Br2S/c1-3-4(6)2-5(7)8-3/h2H,1H3 |
| InChIKey | OGAJGUIMFMRGRB-UHFFFAOYSA-N |
| SMILES | C1(C)SC(Br)=CC=1Br |
| CAS DataBase Reference | 29421-73-6 |
Description and Uses
3,5-Dibromo-2-methylthiophene is a useful reagent for the preparation of arylthiophene-substituted norbornadienes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HS Code | 2934999090 |
