A3605412
4',5'-Dichloro-2'-nitroacetanilide , >97.0%(HPLC) , 5462-30-6
Synonym(s):
4′,5′-Dichloro-2′-nitroacetanilide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25g | RMB456.00 | In Stock |
|
| 100g | RMB1632.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-128 °C(lit.) |
| Boiling point: | 418.4±45.0 °C(Predicted) |
| Density | 1.573±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.29±0.70(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C8H6Cl2N2O3/c1-4(13)11-7-2-5(9)6(10)3-8(7)12(14)15/h2-3H,1H3,(H,11,13) |
| InChIKey | ZEGRPTYRAGSSBH-UHFFFAOYSA-N |
| SMILES | C(NC1=CC(Cl)=C(Cl)C=C1[N+]([O-])=O)(=O)C |
| CAS DataBase Reference | 5462-30-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






