A3631812
Diamide , 97%(HPLC) , 10465-78-8
Synonym(s):
N,N,N′,N′-Tetramethylazodicarboxamide;1,1′-Azobis(N,N-dimethylformamide);Azodicarboxylic acid bis(dimethylamide);Diazenedicarboxylic acid bis(N,N-dimethylamide);TMAD
CAS NO.:10465-78-8
Empirical Formula: C6H12N4O2
Molecular Weight: 172.19
MDL number: MFCD00008318
EINECS: 233-951-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25g | RMB303.20 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| 500g | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112 °C |
| Boiling point: | 220.4±23.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | soluble in Methanol |
| form | crystalline |
| pka | -0?+-.0.70(Predicted) |
| color | yellow |
| Water Solubility | water: 19.60-21.00mg/mL, clear to slightly hazy, orange |
| BRN | 1910409 |
| InChI | InChI=1S/C6H12N4O2/c1-9(2)5(11)7-8-6(12)10(3)4/h1-4H3/b8-7+ |
| InChIKey | VLSDXINSOMDCBK-BQYQJAHWSA-N |
| SMILES | C(=O)(/N=N/C(=O)N(C)C)N(C)C |
| CAS DataBase Reference | 10465-78-8(CAS DataBase Reference) |
Description and Uses
Reported to be of use as a thiol oxidizing agent. Diamide has been used to titrate protein glutathiolation to discriminate from other oxidative protein modifications. Treatment increased protein glutathiolation in a concentration-dependent manner and had comparably little effect on protein-protein disulfide formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LQ1041000 |
| F | 4.10 |
| HS Code | 29270000 |






