A3637812
Diethyl 2,6-<WBR>dimethylpyridine-<WBR>3,5-<WBR>dicarboxylate , 99% , 1149-24-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB166.40 | In Stock |
|
| 5G | RMB741.60 | In Stock |
|
| 10g | RMB1241.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C (lit.) |
| Boiling point: | 208 °C/40 mmHg (lit.) |
| Density | 1.1667 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.81±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C13H17NO4/c1-5-17-12(15)10-7-11(13(16)18-6-2)9(4)14-8(10)3/h7H,5-6H2,1-4H3 |
| InChIKey | DIIWSYPKAJVXBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(C)nc1C |
Description and Uses
Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate is formed during the oxidation of 4-substituted Hantsch dihydropyridines in presence of methanesulfonic acid, sodium nitrite and wet SiO2 as oxidizing agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


