A3639812
3,4-Dichlorocinnamic acid , 97% , 1202-39-7
CAS NO.：1202-39-7
Empirical Formula: C9H6Cl2O2
Molecular Weight: 217.05
MDL number: MFCD00004385
EINECS: 214-866-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB53.60 | In Stock |
|
| 25G | RMB194.40 | In Stock |
|
| 100g | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-220 °C (lit.) |
| Boiling point: | 366.6±32.0 °C(Predicted) |
| Density | 1.457±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble25mg/mL, very slightly hazy, faintly yellow |
| pka | 4.18±0.10(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| BRN | 1872129 |
| InChI | InChI=1S/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13) |
| InChIKey | RRLUFPHCTSFKNR-DUXPYHPUSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(Cl)C(Cl)=C1 |
| CAS DataBase Reference | 1202-39-7(CAS DataBase Reference) |
Description and Uses
3,4-Dichlorocinnamic acid was used in the preparation of indolopiperidine CCR2B receptor antagonists possessing a conformationally restricted C-5 linker chain and a restricted piperidine ring.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | UD3333900 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
