A3640312
Desoxyanisoin , 98% , 120-44-5
Synonym(s):
4′-Methoxy-2-(4-methoxyphenyl)acetophenone
CAS NO.：120-44-5
Empirical Formula: C16H16O3
Molecular Weight: 256.3
MDL number: MFCD00008406
EINECS: 204-396-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB263.20 | In Stock |
|
| 100G | RMB919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C (lit.) |
| Boiling point: | 339.54°C (rough estimate) |
| Density | 1.115 |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Sparingly soluble in water. |
| BRN | 1536594 |
| InChI | InChI=1S/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
| InChIKey | SICBLYCPRWNHHP-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C=C1)CC1=CC=C(OC)C=C1 |
| CAS DataBase Reference | 120-44-5(CAS DataBase Reference) |
| EPA Substance Registry System | Desoxyanisoin (120-44-5) |
Description and Uses
Deoxyanisoin react to produce a-bromo-4,4'-dimethoxy-deoxybenzoin, and this reaction could happen in the reagent of CCl4 and bromine.
