A3643512
2,2-<WBR>Difluoro-<WBR>1,3-<WBR>benzodioxole-<WBR>4-<WBR>carboxylic acid , 97% , 126120-85-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB263.20 | In Stock |
|
| 5g | RMB1079.20 | In Stock |
|
| 25g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-205°C |
| Boiling point: | 260.8±40.0 °C(Predicted) |
| Density | 1.66±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.49±0.40(Predicted) |
| color | White to Off-White |
| BRN | 7292629 |
| InChI | 1S/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
| InChIKey | ZGAQVJDFFVTWJK-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc2OC(F)(F)Oc12 |
| CAS DataBase Reference | 126120-85-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H400 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50-41-22 |
| Safety Statements | 26-36-61-39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







