A3666012
9,9-<WBR>Dioctylfluorene-<WBR>2,7-<WBR>diboronic acid , 96% , 258865-48-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB151.20 | In Stock |
|
| 1G | RMB442.40 | In Stock |
|
| 5G | RMB1526.40 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-162 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White to off-white |
| InChI | 1S/C29H44B2O4/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(30(32)33)15-17-25(27)26-18-16-24(31(34)35)22-28(26)29/h15-18,21-22,32-35H,3-14,19-20H2,1-2H3 |
| InChIKey | HURJMQMZDPOUOU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(ccc2-c3ccc(cc13)B(O)O)B(O)O |
Description and Uses
9,9-Dioctylfluorene-2,7-diboronic acid can be used as a reactant to synthesize hyperbranched conjugated conductive copolymers by Pd-catalyzed Suzuki-Miyaura cross coupling (SMC) copolymerization reaction with different dibromoarenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
