A1181012
4-Biphenylboronic acid , 98% , 5122-94-1
CAS NO.：5122-94-1
Empirical Formula: C12H11BO2
Molecular Weight: 198.03
MDL number: MFCD00093311
EINECS: 675-084-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB454.40 | In Stock |
|
| 500g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-245 °C (lit.) |
| Boiling point: | 385.5±35.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Acetone,Methanol |
| pka | 8.61±0.10(Predicted) |
| form | Powder |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 2937410 |
| InChI | InChI=1S/C12H11BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,14-15H |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C2)C=C1)(O)O |
| CAS DataBase Reference | 5122-94-1(CAS DataBase Reference) |
Description and Uses
Used in Suzuki reactions and as intermediates of liquid crystals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36-24/25 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
