A1440912
Biphenyl-3-carboxylic acid , ≥98.0%(GC) , 716-76-7
CAS NO.：716-76-7
Empirical Formula: C13H10O2
Molecular Weight: 198.22
MDL number: MFCD00045846
EINECS: 671-702-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.92 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB508.00 | In Stock |
|
| 100g | RMB1560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-169 °C |
| Boiling point: | 107 °C(Press: 2 Torr) |
| Density | 1.185±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 4.14±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to beige |
| Water Solubility | Insoluble |
| InChI | InChI=1S/C13H10O2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H,14,15) |
| InChIKey | XNLWJFYYOIRPIO-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 716-76-7(CAS DataBase Reference) |
Description and Uses
3-Biphenylcarboxylic Acid is a ortho-substituted biphenyl with inhibitory effect on glyceride synthesis. 3-Biphenylcarboxylic Acid is an anlogue of Diflusinal (D445751) and shows allosteric modulatory effects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-51/53-36-22 |
| Safety Statements | 37/39-26-61-53 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | TY3100000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
