A3667012
1,2-<WBR>Diiodotetrafluorobenzene , 99% , 2708-97-6
CAS NO.:2708-97-6
Empirical Formula: C6F4I2
Molecular Weight: 401.87
MDL number: MFCD00019011
EINECS: 220-303-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB135.20 | In Stock |
|
| 1g | RMB239.20 | In Stock |
|
| 5G | RMB540.80 | In Stock |
|
| 25g | RMB2648.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-50 °C (lit.) |
| Boiling point: | 232.6±40.0 °C(Predicted) |
| Density | 2.671±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| form | crystalline solid |
| color | Off-white to faint yellow |
| InChI | InChI=1S/C6F4I2/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | JQBYIZAYQMMVTO-UHFFFAOYSA-N |
| SMILES | C1(F)=C(I)C(I)=C(F)C(F)=C1F |
| CAS DataBase Reference | 2708-97-6(CAS DataBase Reference) |
Description and Uses
1,2,3,4-Tetrafluoro-5,6-diiodobenzene is used in perfluorinated graded index polymer optical fiber as a dopant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






