A3669112
2,2′-Dimethoxy-1,1′-binaphthalene , 97% , 2960-93-2
Synonym(s):
(±)-1,1′-Bi-2-naphthol dimethyl ether;2,2′-Dimethoxy-1,1′-binaphthyl
| Pack Size | Price | Stock | Quantity |
| 1G | RMB160.00 | In Stock |
|
| 5g | RMB594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-231 °C(lit.) |
| Boiling point: | 414.05°C (rough estimate) |
| Density | 1.160 |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C22H18O2/c1-23-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)24-2/h3-14H,1-2H3 |
| InChIKey | BJAADAKPADTRCH-UHFFFAOYSA-N |
| SMILES | C1(C2=C3C(C=CC=C3)=CC=C2OC)=C2C(C=CC=C2)=CC=C1OC |
Description and Uses
2,2'-Dimethoxy-1,1'-binaphthyl is used as organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 41-50/53-37/38 |
| Safety Statements | 26-36/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29093090 |





![(2,2'-Dimethoxy-[1,1'-binaphthalene]-3,3'-diyl)diboronicacid](https://img.chemicalbook.com/CAS/GIF/220204-00-2.gif)


