A3673812
3,5-<WBR>Dichlorophenyldiazonium tetrafluoroborate , 98% , 350-67-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB199.20 | In Stock |
|
| 5G | RMB687.20 | In Stock |
|
| 25G | RMB2381.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | DMSO (Sparingly), Methanol (Soluble), Water (Very Slightly) |
| form | Solid |
| color | Pale Orange to Orange |
| InChI | InChI=1S/C6H3Cl2N2.BF4/c7-4-1-5(8)3-6(2-4)10-9;2-1(3,4)5/h1-3H;/q+1;-1 |
| InChIKey | XSVOZXRITFTBIY-UHFFFAOYSA-N |
| SMILES | [B+3]([F-])([F-])([F-])[F-].[N+](C1C=C(Cl)C=C(Cl)C=1)#N |
Description and Uses
Reactant for:
- Electron transfer chemistry
- Microwave-accelerated cross-coupling reactions
- Sandmeyer bromination for preparation of bromobenzene derivatives
- Catalytic thiocyanation in the presence of copper salts
- Electrochemical reduction
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 29270000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |



