A3676512
3,4-<WBR>Difluoro-<WBR>2-<WBR>(2-<WBR>fluoro-<WBR>4-<WBR>iodophenylamino)<WBR>benzoic acid , 98% , 391211-97-5
CAS NO.:391211-97-5
Empirical Formula: C13H7F3INO2
Molecular Weight: 393.1
MDL number: MFCD08690072
EINECS: 809-435-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB152.00 | In Stock |
|
| 250mg | RMB453.60 | In Stock |
|
| 1G | RMB1103.20 | In Stock |
|
| 5g | RMB3408.80 | In Stock |
|
| 10g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-191°C |
| Boiling point: | 370.1±42.0 °C(Predicted) |
| Density | 1.939±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.25±0.36(Predicted) |
| color | Off-White to Beige |
| InChI | InChI=1S/C13H7F3INO2/c14-8-3-2-7(13(19)20)12(11(8)16)18-10-4-1-6(17)5-9(10)15/h1-5,18H,(H,19,20) |
| InChIKey | REMYZOSCCVDLDL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F |
Description and Uses
Intermediate in the preparation of MEK inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






