A3678512
4,4-Difluoro-<SC>L</SC>-prolinamide hydrochloride , 97% , 426844-51-1
Synonym(s):
(S)-4,4-Difluoropyrolidine-2-carboxamide hydrochloride
CAS NO.:426844-51-1
Empirical Formula: C5H9ClF2N2O
Molecular Weight: 186.59
MDL number: MFCD06797014
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB272.00 | In Stock |
|
| 500MG | RMB503.20 | In Stock |
|
| 1g | RMB850.40 | In Stock |
|
| 5g | RMB2563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Grey to Light Grey |
| optical activity | [α]/D 23±5°, c = 0.5 in H2O |
| InChI | InChI=1/C5H8F2N2O.ClH/c6-5(7)1-3(4(8)10)9-2-5;/h3,9H,1-2H2,(H2,8,10);1H/t3-;/s3 |
| InChIKey | RRQDQYAEZGKHOB-OQFXAWDINA-N |
| SMILES | C1[C@@H](C(N)=O)NCC1(F)F.Cl |&1:1,r| |
Description and Uses
4,4-Difluoro-L-prolinamide hydrochloride can be used as a building block in the synthesis of cyanopyrrolidine based DPP-IV inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






