A3683912
4,5-<WBR>Dimethoxy-<WBR>2-<WBR>nitrobenzyl bromide , 97% , 53413-67-5
Synonym(s):
6-Nitroveratryl bromide
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB83.20 | In Stock |
|
| 1G | RMB234.40 | In Stock |
|
| 5G | RMB827.20 | In Stock |
|
| 25g | RMB3079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C (lit.) |
| Boiling point: | 372.3±37.0 °C(Predicted) |
| Density | 1.544 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder or Needles |
| color | Yellow to brown |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C9H10BrNO4/c1-14-8-3-6(5-10)7(11(12)13)4-9(8)15-2/h3-4H,5H2,1-2H3 |
| InChIKey | UEKFEYNZISYRRH-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(OC)=C(OC)C=C1[N+]([O-])=O |
Description and Uses
1-(Bromomethyl)-4,5-dimethoxy-2-nitrobenzene is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |







