A6163512
2-Nitrobenzyl bromide , 97% , 3958-60-9
Synonym(s):
α-Bromo-2-nitrotoluene
CAS NO.:3958-60-9
Empirical Formula: C7H6BrNO2
Molecular Weight: 216.03
MDL number: MFCD00007184
EINECS: 223-558-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 100G | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46 °C (lit.) |
| Boiling point: | 265.51°C (rough estimate) |
| Density | 1.6841 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Crystals or Crystalline Powder |
| color | Yellow to light brown |
| Water Solubility | insoluble |
| BRN | 638991 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H6BrNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| InChIKey | HXBMIQJOSHZCFX-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 3958-60-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Nitrobenzyl bromide(3958-60-9) |
Description and Uses
2-Nitrobenzyl bromide was used for caging unprotected cysteine-containing or thiophosphorylated peptides in aqueous solution. It can be used in the synthesis of (R)- and (S)-3-amino-3,4-dihydro-1H-quinolin-2-one.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P280-P303+P361+P353-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 4.8-19-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








