A1392012
4-Bromomethyl-3-nitrobenzoic acid , 97% , 55715-03-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB130.40 | In Stock |
|
| 5G | RMB432.80 | In Stock |
|
| 10g | RMB827.20 | In Stock |
|
| 25G | RMB1540.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-130 °C (lit.) |
| Boiling point: | 392°C |
| Density | 1.814 |
| refractive index | 1.6500 (estimate) |
| Flash point: | 191°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF: soluble(lit.) |
| pka | 3.42±0.10(Predicted) |
| form | solid |
| Water Solubility | Soluble in DMF and dichloromethane. Insoluble in water. |
| BRN | 1970939 |
| InChI | 1S/C8H6BrNO4/c9-4-6-2-1-5(8(11)12)3-7(6)10(13)14/h1-3H,4H2,(H,11,12) |
| InChIKey | QMAHVAFURJBOFV-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(CBr)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 55715-03-2(CAS DataBase Reference) |
Description and Uses
Photolabile Nbb handle employed in solid-phase peptide synthesis:
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






