A6173512
3-Nitrobenzoic acid , 99% , 121-92-6
Synonym(s):
3-Nitrobenzoic acid
CAS NO.:121-92-6
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00007251
EINECS: 204-508-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB20.00 | In Stock |
|
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB57.60 | In Stock |
|
| 250g | RMB111.20 | In Stock |
|
| 500G | RMB152.00 | In Stock |
|
| 2.5kg | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C(lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| Density | 1,494 g/cm3 |
| bulk density | 700kg/m3 |
| vapor density | 5.76 (vs air) |
| vapor pressure | 0.005Pa at 25℃ |
| refractive index | 1.6280 (estimate) |
| Flash point: | 190 °C |
| storage temp. | no restrictions. |
| solubility | water: soluble3g/L at 25°C |
| form | Crystals or Powder |
| pka | 3.47(at 25℃) |
| color | Slightly green to light yellow |
| PH | 3 (5g/l, H2O, 20℃)(aqueous suspension) |
| PH Range | 3 |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Merck | 14,6588 |
| BRN | 908644 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | AFPHTEQTJZKQAQ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(c1)[N+]([O-])=O |
| LogP | 1.1 at 25℃ |
| CAS DataBase Reference | 121-92-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3-nitro-(121-92-6) |
| EPA Substance Registry System | m-Nitrobenzoic acid (121-92-6) |
Description and Uses
3-Nitrobenzoic acid was used to investigated the role of ozone as additional decomposition or finishing reagent in the degradation of o-, m- and p-nitobenzoic acids
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37-33-36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| RTECS | DH5000000 |
| Autoignition Temperature | 490 °C |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
| Hazardous Substances Data | 121-92-6(Hazardous Substances Data) |





