A5507112
5-Methyl-2-nitrobenzoic acid , 98% , 3113-72-2
Synonym(s):
6-Nitro-m-toluic acid
CAS NO.:3113-72-2
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007368
EINECS: 221-481-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB109.60 | In Stock |
|
| 500g | RMB452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-136 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder or Crystalline Powder |
| pka | 2.21±0.25(Predicted) |
| color | White to yellow |
| Water Solubility | 4.7g/L(20 ºC) |
| BRN | 1959031 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H7NO4/c1-5-2-3-7(9(12)13)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | QRRSIFNWHCKMSW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 3113-72-2(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Methyl-2-nitrobenzoic acid (3113-72-2) |
Description and Uses
5-Methyl-2-nitrobenzoic acid is used in the preparation of methyl-N-(5-methyl-2-nitrophenyl) carbamate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |




