A3684612
2,5-<WBR>Dihydroxy-<WBR>1,4-<WBR>benzenediacetic acid , 95% , 5488-16-4
CAS NO.:5488-16-4
Empirical Formula: C10H10O6
Molecular Weight: 226.18
MDL number: MFCD00004325
EINECS: 226-819-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB159.20 | In Stock |
|
| 1G | RMB332.00 | In Stock |
|
| 5G | RMB1479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 281-283 °C (dec.) (lit.) |
| Boiling point: | 327.79°C (rough estimate) |
| Density | 1.4225 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder or crystals |
| pka | 3.83±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H10O6/c11-7-1-5(3-9(13)14)8(12)2-6(7)4-10(15)16/h1-2,11-12H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | MCLKERLHVBEZIW-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(O)=C(CC(O)=O)C=C1O |
| CAS DataBase Reference | 5488-16-4 |
Description and Uses
2,5-DIHYDROXY-1,4-BENZENEDIACETIC ACID is used as a ligand in the synthesis of MOF materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




