A3688512
Diisopropanol-p-toluidine , ≥99% , 38668-48-3
CAS NO.:38668-48-3
Empirical Formula: C13H21NO2
Molecular Weight: 223.31
MDL number: MFCD00035945
EINECS: 254-075-1
| Pack Size | Price | Stock | Quantity |
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60 - 63°C |
| Boiling point: | 389.0±32.0 °C(Predicted) |
| Density | 1.086±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 185.00°C |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 14.46±0.20(Predicted) |
| color | White to Pale Brown |
| Water Solubility | 7g/L at 20℃ |
| InChI | InChI=1S/C13H21NO2/c1-10-4-6-13(7-5-10)14(8-11(2)15)9-12(3)16/h4-7,11-12,15-16H,8-9H2,1-3H3 |
| InChIKey | JFZVSHAMRZPOPA-UHFFFAOYSA-N |
| SMILES | N(CC(O)C)(CC(O)C)C1=CC=C(C)C=C1 |
| LogP | 2.1 at 24℃ |
| EPA Substance Registry System | 2-Propanol, 1,1'-[(4-methylphenyl)imino]bis- (38668-48-3) |
Description and Uses
Diisopropanol-p-toluidine is used in the polymerization of dental composite resins, acting as an accelerator.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338 |
| RIDADR | 2811 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |






