A3718912
2,6-dibromo-3-nitropyridine , 97% , 55304-80-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78 °C |
| Boiling point: | 295.8±35.0 °C(Predicted) |
| Density | 2+-.0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -7.68±0.10(Predicted) |
| form | Solid |
| color | Dark Yellow |
| InChI | InChI=1S/C5H2Br2N2O2/c6-4-2-1-3(9(10)11)5(7)8-4/h1-2H |
| InChIKey | FFRFTURYWWFKIC-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(Br)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 55304-80-8(CAS DataBase Reference) |
Description and Uses
2,6-Dibromo-3-nitropyridine is a useful reagent for organic synthesis and other chemical processes. It is used as a reagent in the synthesis of amino(carbamoylmethyl) pyridones as factor VIIa inhibitors and anticoagulants.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| HS Code | 29333990 |







