A3755412
3,5-Difluoro-4-(trifluoromethyl)bromobenzene , 98% , 156243-64-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB110.40 | In Stock |
|
| 5G | RMB404.00 | In Stock |
|
| 25G | RMB1751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 187.1±35.0℃ (760 Torr) |
| Density | 1.768±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 66.9±25.9℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Colorless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H2BrF5/c8-3-1-4(9)6(5(10)2-3)7(11,12)13/h1-2H |
| InChIKey | QPJKIRNIIXIPIE-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC(F)=C1C(F)(F)F |
Description and Uses
It is employed in the lewis acid-promoted synthesis of unsymmetrical and highly functionalized carbazoles and dibenzofurans from biaryl triazenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-23 |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
