A3768656
4-Bromo-2-chlorothiophene , ≥95% , 32431-93-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB831.20 | In Stock |
|
| 100mg | RMB1624.80 | In Stock |
|
| 1g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67-69 °C(Press: 9 Torr) |
| Density | 1.844±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C4H2BrClS/c5-3-1-4(6)7-2-3/h1-2H |
| InChIKey | FEDTVFXCDOSSOK-UHFFFAOYSA-N |
| SMILES | C1(Cl)SC=C(Br)C=1 |
Description and Uses
4-Bromo-2-chlorothiophene is a thiophene derivative used in the preparation of potential hypolipidemic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H332-H315-H319-H335-H312-H227 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501-P210-P280-P370+P378-P403+P235-P501-P264-P280-P305+P351+P338-P337+P313P-P261-P271-P304+P340-P312 |
