A3770612
2,4-Dichloro-6-nitroaniline , 98% , 2683-43-4
CAS NO.:2683-43-4
Empirical Formula: C6H4Cl2N2O2
Molecular Weight: 207.01
MDL number: MFCD00007664
EINECS: 220-241-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB235.20 | In Stock |
|
| 25g | RMB1015.20 | In Stock |
|
| 100G | RMB3711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103 °C (lit.) |
| Boiling point: | 360.98°C (rough estimate) |
| Density | 1.6257 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | pK1:-3.00(+1) (25°C) |
| color | Yellow to Very Dark Yellow |
| BRN | 642902 |
| InChI | 1S/C6H4Cl2N2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 |
| InChIKey | IZEZAMILKKYOPW-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 2683-43-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Dichloro-6-nitroaniline (2683-43-4) |
Description and Uses
2,4-Dichloro-6-nitroaniline was used to design a faster-reacting, more intensely fluorescent pH probe based on rhodamine spirolactam structure.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H411 |
| Precautionary statements | P262-P264-P273-P280-P302+P352+P310-P304+P340+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N,T+ |
| Risk Statements | 20/21/22-36/37/38-51/53-33-26/27/28 |
| Safety Statements | 26-37/39-61-45-36/37-28 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 1 Oral Aquatic Chronic 2 STOT RE 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








