A3777812
7-Deazaxanthine , 95% , 39929-79-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1G | RMB103.20 | In Stock |
|
| 5g | RMB359.20 | In Stock |
|
| 25g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C |
| Density | 1.516±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMF, DMSO (Slightly) |
| pka | 11.22±0.20(Predicted) |
| form | Solid |
| color | Brown to Black |
| InChI | InChI=1S/C6H5N3O2/c10-5-3-1-2-7-4(3)8-6(11)9-5/h1-2H,(H3,7,8,9,10,11) |
| InChIKey | HASUWNAFLUMMFI-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(=O)C2C=CNC=2N1 |
Description and Uses
2,4-Dihydroxypyrrolo[2,3-d]pyrimidine (cas# 39929-79-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| HS Code | 2933599590 |
| REACH Registrations | Active |





![N-Methyl-N-((3S,4S)-4-methylpiperidin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine](https://img.chemicalbook.com/CAS/GIF/1260614-73-0.gif)

