A3790112
2,4-Dichloro-6-nitrophenol , 97% , 609-89-2
CAS NO.:609-89-2
Empirical Formula: C6H3Cl2NO3
Molecular Weight: 208
MDL number: MFCD00007101
EINECS: 210-202-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB90.40 | In Stock |
|
| 25G | RMB287.20 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C (lit.) |
| Boiling point: | 242.8±35.0 °C(Predicted) |
| Density | 1.5643 (rough estimate) |
| refractive index | 1.6390 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 4?+-.0.38(Predicted) |
| color | Yellow |
| BRN | 2050081 |
| InChI | 1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H |
| InChIKey | LYPMXMBQPXPNIQ-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 609-89-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2,4-dichloro-6-nitro-(609-89-2) |
Description and Uses
2,4-Dichloro-6-nitrophenol, a specific inhibitor of sulfotransferases, was used to reduce the neosynthesis of [3H] pregnenolone sulfate (Δ5PS) and [3H]dehydroepiandrosterone sulfate (DHEAS).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H315-H332-H335-H302-H319 |
| Precautionary statements | P305+P351+P338-P261-P280-P304+P340-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36-41-20/21/22 |
| Safety Statements | 26-36/37/39-28 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | SL0350000 |
| F | 4.5 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |




