A3824712
DIBUTYLBORON TRIFLUOROMETHANESULFONATE , 0.7mol/Lindiethylether,Energyseal , 60669-69-4
Synonym(s):
Dibutylboron triflate solution
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB575.20 | In Stock |
|
| 100ML | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 37℃ (0.12 Torr) |
| Density | 1.271 g/mL at 25 °C |
| Flash point: | 80 °F |
| storage temp. | 2-8°C |
| form | Solution |
| color | Clear light yellow to orange |
| BRN | 1968660 |
| InChI | InChI=1S/C9H18BF3O3S/c1-3-5-7-10(8-6-4-2)16-17(14,15)9(11,12)13/h3-8H2,1-2H3 |
| InChIKey | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| SMILES | B(CCCC)(CCCC)OS(=O)(=O)C(F)(F)F |
Description and Uses
Dibutylboryl trifluoromethanesulfonate may be used in the following studies:
- Stereo- and regio-selective synthesis of erythro aldols.
- As a promoter for the solution and polymer-supported trichloroacetimidate-based glycosylations.
- Synthesis of β-alkoxy carbonyl compounds via one-step Mukaiyama aldol-type reaction.
- Aldol-type cyclization for the stereoselective synthesis of cyclic ethers.
- As a reagent for the formation of boron enolates.
- As a complexation aid for the isolation of 1-acyldipyrromethanes.
- As a promoter in [1,2]-Wittig reaction between aldehydes and O-benzyl or O-allyl glycolate esters, creating two contiguous stereocenters (1,2-diol) in good yield without the need for strong base.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H314-H335-H336-H351-H373 |
| Precautionary statements | P261-P280-P305+P351+P338-P310 |
| target organs | Central nervous system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F+,F |
| Risk Statements | 12-22-34-66-67-40-10-37-65-48/20-11-63-19 |
| Safety Statements | 9-16-26-33-36/37/39-45-62 |
| RIDADR | UN 2924 3/PG 1 |
| WGK Germany | 3 |
| F | 1-10 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Carc. 2 Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B STOT SE 3 |










