A3838512
DL-2-(2-Chlorophenyl)glycine , 98% , 141196-64-7
CAS NO.：141196-64-7
Empirical Formula: C8H8ClNO2
Molecular Weight: 185.61
MDL number: MFCD00049324
EINECS: 672-355-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB132.80 | In Stock |
|
| 25G | RMB517.60 | In Stock |
|
| 100G | RMB1540.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| InChI | InChI=1S/C8H8ClNO2/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12) |
| InChIKey | LMIZLNPFTRQPSF-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1Cl)C(N)C(=O)O |
| CAS DataBase Reference | 141196-64-7(CAS DataBase Reference) |
Description and Uses
DL-2-(2-Chlorophenyl)glycine can be used as an intermediate of antithrombotic drug flupidogrel.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-23 |
