Rhodamine 123 , 98%
Synonym(s):
2-(6-Amino-3-imino-3H-xanthen-9-yl)benzoic acid methyl ester
CAS NO.:
Empirical Formula: C21H17ClN2O3
Molecular Weight: 380.83
MDL number: MFCD00012664
EINECS: 263-687-8
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB119.20 | In Stock |
|
| 25mg | RMB423.20 | In Stock |
|
| 100MG | RMB1359.20 | In Stock |
|
| 500MG | RMB4639.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 235 °C |
| Density | 1.2224 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | ethanol: 20 mg/mL, clear, red |
| form | Powder |
| color | Red-brown to brown or dark green |
| Appearance | brown crystals |
| Water Solubility | Partially soluble |
| λmax | 501 nm, 507 nm |
| BRN | 6030951 |
| Stability: | Hygroscopic |
| Biological Applications | Measuring membrane potential; detecting cancer cells,spores,prostate cancer,stress biomarkers; treating disc degenerative disease,epilepsy,erectile dysfunction; apoptosis assays; tumor cell multidrug resistance assay; implantable |
| Major Application | Colored bubbles; color
filters; liquid crystal displays; light-emitting diodes;
luminescent materials;nanophotonic composites;
paints; semiconductor electrodes;solar cells |
| InChI | 1S/C21H16N2O3.ClH/c1-25-21(24)15-5-3-2-4-14(15)20-16-8-6-12(22)10-18(16)26-19-11-13(23)7-9-17(19)20;/h2-11,22H,23H2,1H3;1H |
| InChIKey | MYFATKRONKHHQL-UHFFFAOYSA-N |
| SMILES | Cl[H].COC(=O)c1ccccc1C2=C3C=CC(=N)C=C3Oc4cc(N)ccc24 |
| CAS DataBase Reference | 62669-70-9(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthylium, 3,6-diamino-9-[2-(methoxycarbonyl)phenyl]-, chloride (62669-70-9) |
Description and Uses
Rhodamine 123 is a membrane-permeable cationic dye that is readily accumulated within living cells. It is a substrate for the efflux pump P-glycoprotein (P-gp; also known as multidrug resistance protein 1 and ABCB1) and is rapidly exported from cells with functional P-gp. As P-gp is expressed on a population of stem cells known as the side population, rhodamine 123 is used to detect this group of stem cells. Rhodamine 123 also accumulates within mitochondria due to its positive charge and can inhibit oxidative phosphorylation. Rhodamine 123 has excitation/emission maxima of 507/529 nm.
Rhodamine-123 lycoprotein (P-gp) functional efflux activity in vivo. Rhodamine-123 PE-Cy5 and AMCA (7-amino-4-methylcoumarin-3-acetic acid).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | ZE0883000 |
| TSCA | TSCA listed |
| HS Code | 32049010 |
| Storage Class | 11 - Combustible Solids |




