A3860812
Dimethyl 1H-pyrazole-3,5-dicarboxylate , 97% , 4077-76-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB34.40 | In Stock |
|
| 1G | RMB84.24 | In Stock |
|
| 5g | RMB224.00 | In Stock |
|
| 25g | RMB562.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-152℃ |
| Boiling point: | 344℃ |
| Density | 1.346 |
| Flash point: | 162℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 8.08±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C7H8N2O4/c1-12-6(10)4-3-5(9-8-4)7(11)13-2/h3H,1-2H3,(H,8,9) |
| InChIKey | SIPQVJNEQSWAOK-UHFFFAOYSA-N |
| SMILES | N1C(C(OC)=O)=CC(C(OC)=O)=N1 |
Description and Uses
Dimethyl 1H-Pyrazole-3,5-dicarboxylate is used in preparation of substituted Dihydropyrazolopyrazinecarboxamide derivatives as EP3 receptor antagonists useful for treating diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P280 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
