A6902912
Pyrazole-3-carboxylic Acid , >98.0%(HPLC) , 1621-91-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB188.00 | In Stock |
|
| 100g | RMB527.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211°C |
| Boiling point: | 417.1±18.0 °C(Predicted) |
| Density | 1.524±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 3.98±0.10(Predicted) |
| form | Powder |
| color | White |
| λmax | 260nm(MeOH)(lit.) |
| InChI | InChI=1S/C4H4N2O2/c7-4(8)3-1-2-5-6-3/h1-2H,(H,5,6)(H,7,8) |
| InChIKey | KOPFEFZSAMLEHK-UHFFFAOYSA-N |
| SMILES | N1C=CC(C(O)=O)=N1 |
| CAS DataBase Reference | 1621-91-6(CAS DataBase Reference) |
Description and Uses
1H-pyrazole-3-carboxylic Acid is a histone lysine demethylase KDM4C and proline racemase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |







