BD8427031
1-Methyl-1H-pyrazole-4-sulfonyl chloride , 98% , 288148-34-5
CAS NO.：288148-34-5
Empirical Formula: C4H5ClN2O2S
Molecular Weight: 180.61
MDL number: MFCD04968667
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1g | RMB115.20 | In Stock |
|
| 5g | RMB370.40 | In Stock |
|
| 10g | RMB701.60 | In Stock |
|
| 25g | RMB1364.80 | In Stock |
|
| 100g | RMB4861.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 295.7±13.0 °C(Predicted) |
| Density | 1.60±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | crystalline solid |
| pka | -3.33±0.10(Predicted) |
| color | White |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4H5ClN2O2S/c1-7-3-4(2-6-7)10(5,8)9/h2-3H,1H3 |
| InChIKey | RDAVKKQKMLINOH-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(S(Cl)(=O)=O)C=N1 |
Description and Uses
1-Methyl-1H-pyrazole-4-sulfonyl Chloride is used as a reagent in the preparation of benzoindazoles as glucocorticoid receptor modulators.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | UN3265 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 8 |
| HS Code | 2933199090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
