A3862612
Dibenzo[b,e]oxepin-11(6H)-one , 97% , 4504-87-4
CAS NO.:4504-87-4
Empirical Formula: C14H10O2
Molecular Weight: 210.23
MDL number: MFCD00963963
EINECS: 224-820-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB80.80 | In Stock |
|
| 1G | RMB191.20 | In Stock |
|
| 5g | RMB319.20 | In Stock |
|
| 10g | RMB479.20 | In Stock |
|
| 25G | RMB659.20 | In Stock |
|
| 100G | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70C |
| Boiling point: | 386.8±32.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) , Methanol (Slightly) |
| form | Solid |
| color | Off-White to Light Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C14H10O2/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h1-8H,9H2 |
| InChIKey | YUSHFLBKQQILNV-UHFFFAOYSA-N |
| SMILES | O1CC2=CC=CC=C2C(=O)C2=CC=CC=C12 |
| CAS DataBase Reference | 4504-87-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Dibenz[b,e]oxepin-11(6H)-one(4504-87-4) |
Description and Uses
Doxepin intermediate. A photodecomposition product of Doxepin.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2932996560 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |

![Dibenzo[b,e]oxepin-11(6H)-one](https://img.chemicalbook.com/CAS/GIF/4504-87-4.gif)


