A3872312
2,4-Dihydroxy-6-trifluoromethylpyrimidine , 95% , 672-45-7
CAS NO.：672-45-7
Empirical Formula: C5H3F3N2O2
Molecular Weight: 180.08
MDL number: MFCD01011762
EINECS: 211-593-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB25.60 | In Stock |
|
| 1G | RMB62.40 | In Stock |
|
| 5g | RMB289.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-235 °C (lit.) |
| Density | 1.554±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.70±0.10(Predicted) |
| form | Powder |
| Appearance | White to off-white Solid |
| InChI | 1S/C5H3F3N2O2/c6-5(7,8)2-1-3(11)10-4(12)9-2/h1H,(H2,9,10,11,12) |
| InChIKey | IROWWTVZNHKLLE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1=CC(=O)NC(=O)N1 |
| CAS DataBase Reference | 672-45-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Uracil, 6-(trifluoromethyl)-,(672-45-7) |
Description and Uses
6-(Trifluoromethyl)-2,4(1H,3H)-pyrimidinedione is an anticancer drug, produced from catalytic trifluoromethylation of uracil.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
