A3888112
Dimethyl <small>L</small>-(+)-Tartrate , ≥99.0%,≥99.0%e.e. , 608-68-4
Synonym(s):
L -(+)-Tartaric acid dimethyl ester
CAS NO.:608-68-4
Empirical Formula: C6H10O6
Molecular Weight: 178.14
MDL number: MFCD00064437
EINECS: 210-166-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C (dec.) (lit.) |
| Boiling point: | 163 °C/23 mmHg (lit.) |
| alpha | 21 º (c=10, H2O) |
| Density | 1.238 g/mL at 25 °C (lit.) |
| refractive index | 21 ° (C=2.5, H2O) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals |
| pka | 11.44±0.20(Predicted) |
| color | White |
| Specific Gravity | 1.3046 (50/4℃) |
| optical activity | [α]22/D +21°, c = 2.5 in H2O |
| Water Solubility | Soluble in water. |
| BRN | 1726256 |
| Cosmetics Ingredients Functions | NOT REPORTED |
| InChI | 1S/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4-/m1/s1 |
| InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@H](O)[C@@H](O)C(=O)OC |
| LogP | -1.350 (est) |
| CAS DataBase Reference | 608-68-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, dimethyl ester(608-68-4) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, dimethyl ester (608-68-4) |
Description and Uses
(+)-Dimethyl L-tartrate can react with sulfur tetrafluoride to form dimethyl meso-2,3-difluorosuccinate.
It may be used in the synthesis of the following chiral ligands for use in asymmetric synthesis:
- (2R, 3R)-1,4-dimethoxy-1,1,4,4-tetraphenyl-2,3-butanediol
- (-)-(4S,5R)-4-(2-pyridyl)-5-(diphenylphosphino)methyl-2,2-dimethyl-1,3-dioxolane (PYDIPHOS)
- (4R,5R)-α,α,α′,α′-2,2-hexaphenyl-4,5-dimethanol-1,3-dioxolane
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181300 |
| Storage Class | 11 - Combustible Solids |





