A3255612
(+)-Diethyl L-tartrate , 99% , 87-91-2
Synonym(s):
(+)-Diethyl L -tartrate;L -(+)-Tartaric acid diethyl ester
CAS NO.:87-91-2
Empirical Formula: C8H14O6
Molecular Weight: 206.19
MDL number: MFCD00009143
EINECS: 201-783-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB67.20 | In Stock |
|
| 500G | RMB319.20 | In Stock |
|
| 2KG | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17 °C |
| Boiling point: | 280 °C (lit.) |
| alpha | 7.5 º (neat) |
| Density | 1.204 g/mL at 25 °C (lit.) |
| vapor pressure | 0.402Pa at 25℃ |
| FEMA | 2378 | DIETHYL TARTRATE |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Water (Slightly) |
| pka | 11.61±0.20(Predicted) |
| form | Viscous Liquid |
| color | Clear |
| Odor | at 100.00 %. mild fruity wine caramellic |
| Odor Type | fruity |
| biological source | synthetic |
| optical activity | [α]20/D +8.5°, neat |
| Water Solubility | insoluble |
| Merck | 14,3855 |
| JECFA Number | 622 |
| BRN | 1727145 |
| Dielectric constant | 4.5(20℃) |
| Major Application | flavors and fragrances |
| InChI | 1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | YSAVZVORKRDODB-PHDIDXHHSA-N |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC |
| LogP | 0.2 at 25℃ |
| CAS DataBase Reference | 87-91-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl tartrate(87-91-2) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, 1,4-diethyl ester (87-91-2) |
Description and Uses
(+)-Diethyl L-tartrate is used as a chiral auxiliary in the Sharpless enantioselective epoxidation of allylic alcohols, for Sharpless-type enantioselective oxidation of sulfides to sulfoxides and as a chiral auxiliary in the enantioselective construction of cyclopropanes from allylic alcohols by an asymmetric Simmons-Smith reaction. It is also used as a chiral reagent in a host of chemical reactions, such as the synthesis of isoquinoline alkaloids and arundic acid, which has been used in acute ischemic stroke therapy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 |






