A3246712
Diethyl D-(-)-Tartrate , 99% , 13811-71-7
Synonym(s):
(2S,3S)-(-)-Diethyl tartrate;D -(−)-Tartaric acid diethyl ester;L-(+)-Tartaric acid diethyl ester, DET, (-)-Diethyl-D-tartrate
CAS NO.:13811-71-7
Empirical Formula: C8H14O6
Molecular Weight: 206.19
MDL number: MFCD00064451
EINECS: 237-458-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB76.00 | In Stock |
|
| 250g | RMB159.20 | In Stock |
|
| 500G | RMB317.60 | In Stock |
|
| 2.5kg | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17 °C |
| Boiling point: | 162 °C/19 mmHg (lit.) |
| alpha | -9 º (neat) |
| Density | 1.205 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Water (Slightly) |
| pka | 11.61±0.20(Predicted) |
| form | Viscous Liquid |
| color | Clear colorless |
| Specific Gravity | 1.21 |
| optical activity | [α]23/D 8.5°, neat |
| Water Solubility | insoluble |
| Merck | 14,3855 |
| BRN | 1727143 |
| InChI | 1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | YSAVZVORKRDODB-WDSKDSINSA-N |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC |
| CAS DataBase Reference | 13811-71-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanedioic acid, 2,3-dihydroxy-, diethyl ester, [S-(R*,R*)]-(13811-71-7) |
Description and Uses
Diethyl D(-)-tartrate is mainly used in chiral pharmaceuticals, chiral intermediates and chiral catalysts. It can be used with titanium in enolic asymmetric epoxidization. The compound d-alpha-tocopherol is the principal compound present in natural vitamin E sources. At present, d-alpha-tocopherol and other tocopherol derivatives are used in pharmaceuticals, foods and animal feeds. It is used as a food additive.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29181300 |
| Storage Class | 10 - Combustible liquids |






