A3255512
(-)-O,O′-Dibenzoyl-L-tartaric acid monohydrate , 98% , 62708-56-9
Synonym(s):
(-)-Dibenzoyl-L -tartaric Acid Monohydrate
CAS NO.：62708-56-9
Empirical Formula: C18H16O9
Molecular Weight: 376.31
MDL number: MFCD00149119
EINECS: 613-072-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB96.00 | In Stock |
|
| 500G | RMB348.00 | In Stock |
|
| 2.5kg | RMB1164.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-89 °C(lit.) |
| alpha | -115 º (c=5, ethanol) |
| refractive index | -108.5 ° (C=1, EtOH) |
| storage temp. | Store below +30°C. |
| form | Powder |
| color | White |
| optical activity | [α]20/D 110±3°, c = 5% in ethanol |
| Water Solubility | SOLUBLE |
| BRN | 4065263 |
| InChI | InChI=1/C18H14O8.H2O/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;/h1-10,13-14H,(H,19,20)(H,21,22);1H2/t13-,14-;/s3 |
| InChIKey | DXDIHODZARUBLA-DTPOWOMPSA-N |
| SMILES | [C@@H](C(=O)O)(OC(=O)C1C=CC=CC=1)[C@H](C(=O)O)OC(=O)C1C=CC=CC=1.O |&1:0,13,r| |
| CAS DataBase Reference | 62708-56-9(CAS DataBase Reference) |
Description and Uses
(-)-Dibenzoyl-L-tartaric acid is used as an intermediate in pharmaceutical and agro chemical industries. It is used as chiral auxiliary in organic synthesis and as a resolution agent in the synthesis of rameleton.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | WW8070000 |
| F | 3 |
| TSCA | Yes |
| HS Code | 29181990 |
