A3887912
Di-p-toluoyl-L-tartaric acid , ≥99.0% , 32634-66-5
Synonym(s):
L -(-)-DTTA;Di-p-toluyl-L -tartaric acid
CAS NO.:32634-66-5
Empirical Formula: C20H18O8
Molecular Weight: 386.35
MDL number: MFCD00064440
EINECS: 251-131-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB36.00 | In Stock |
|
| 250g | RMB79.20 | In Stock |
|
| 500g | RMB175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-171 °C(lit.) |
| alpha | -142 º (c=10, EtOH) |
| Boiling point: | 432.57°C (rough estimate) |
| Density | 1.3084 (rough estimate) |
| bulk density | 500kg/m3 |
| refractive index | -139 ° (C=1, EtOH) |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 1.46±0.25(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| optical activity | [α]20/D 138°, c = 1 in ethanol |
| Water Solubility | soluble |
| BRN | 2022481 |
| InChI | 1S/C20H18O8/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m1/s1 |
| InChIKey | CMIBUZBMZCBCAT-HZPDHXFCSA-N |
| SMILES | Cc1ccc(cc1)C(=O)O[C@H]([C@@H](OC(=O)c2ccc(C)cc2)C(O)=O)C(O)=O |
| CAS DataBase Reference | 32634-66-5(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, [R-(R*,R*)]- (32634-66-5) |
Description and Uses
(-)-O,O’-Di-p-toluoyl-L-tartaric Acid is a useful reagent for the preparation of the upadacitinib salt compound.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181300 |
| Storage Class | 11 - Combustible Solids |





![N-Methyl-N-((3S,4S)-4-methylpiperidin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine](https://img.chemicalbook.com/CAS/GIF/1260614-73-0.gif)

