A3170712
(+)-Diisopropyl L-tartrate , 99% , 2217-15-4
Synonym(s):
L -(+)-Tartaric acid diisopropyl ester
CAS NO.：2217-15-4
Empirical Formula: C10H18O6
Molecular Weight: 234.25
MDL number: MFCD00064450
EINECS: 218-709-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 17.25 º (neat) |
| Boiling point: | 152 °C/12 mmHg (lit.) |
| Density | 1.114 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Viscous Liquid |
| pka | 11.70±0.20(Predicted) |
| color | Clear colorless |
| Specific Gravity | 1.121.114 |
| optical activity | [α]24/D +17°, neat |
| Sensitive | Hygroscopic |
| BRN | 1727863 |
| InChI | 1S/C10H18O6/c1-5(2)15-9(13)7(11)8(12)10(14)16-6(3)4/h5-8,11-12H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | XEBCWEDRGPSHQH-HTQZYQBOSA-N |
| SMILES | CC(C)OC(=O)[C@H](O)[C@@H](O)C(=O)OC(C)C |
| CAS DataBase Reference | 2217-15-4(CAS DataBase Reference) |
| NIST Chemistry Reference | (+)-Diisopropyl tartrate(2217-15-4) |
Description and Uses
Both D- and L-forms are reagents for kinetic resolution of racemic allylic alcohols and α-furfuryl amides by enantioselective epoxidation.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H341 |
| Precautionary statements | P501-P202-P201-P280-P308+P313-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | WW8100000 |
| HS Code | 29181300 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | mouse,LD50,oral,6300uL/kg (6.3mL/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 93, Pg. 26, 1948. |
