A3932712
Ethyl diazoacetate , 91%,10%dichloromethane , 623-73-4
Synonym(s):
2-Diazoacetic acid ethyl ester solution;DAAE
CAS NO.:623-73-4
Empirical Formula: C4H6N2O2
Molecular Weight: 114.1
MDL number: MFCD00001989
EINECS: 210-810-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22 °C (lit.) |
| Boiling point: | 140-141 °C/720 mmHg (lit.) |
| Density | 1.085 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 115 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Soluble), Hexane (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Light Yellow to Orange |
| Merck | 13,3021 |
| BRN | 107654 |
| InChI | InChI=1S/C4H6N2O2/c1-2-8-4(7)3-6-5/h3H,2H2,1H3 |
| InChIKey | YVPJCJLMRRTDMQ-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)C=[N+]=[N-] |
| NIST Chemistry Reference | Ethyl diazoacetate(623-73-4) |
Description and Uses
Reagent for ruthenium-catalyzed asymmetric cyclopropanation of alkenes.1
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H226-H242-H302-H315-H319-H351 |
| Precautionary statements | P210-P301+P312-P303+P361+P353-P308+P313-P370+P378-P403+P235 |
| Hazard Codes | Xn,F |
| Risk Statements | 5-10-22-40-67-65-48/20-38-11-63 |
| Safety Statements | 36/37-62-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | AG5775000 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 3 Self-react. E Skin Irrit. 2 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Not Permitted as Excepted Quantity |







