A3936312
Ethyl Thiooxamate , 95% , 16982-21-1
Synonym(s):
Ethyl aminothioxoacetate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB139.20 | In Stock |
|
| 100G | RMB543.20 | In Stock |
|
| 500g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-65 °C (lit.) |
| Boiling point: | 199.2±23.0 °C(Predicted) |
| Density | 1.226 (estimate) |
| refractive index | 1.5480 (estimate) |
| Flash point: | 74° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | chloroform: soluble25mg/mL, clear to slightly hazy (colorless to orange) |
| form | Crystalline Powder |
| pka | 11.31±0.29(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C4H7NO2S/c1-2-7-4(6)3(5)8/h2H2,1H3,(H2,5,8) |
| InChIKey | YMBMCMOZIGSBOA-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(N)=S |
| CAS DataBase Reference | 16982-21-1(CAS DataBase Reference) |
Description and Uses
Ethyl thiooxamate was used in the synthesis of functionalized bithiazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Excepted Quantities | Non-Hazardous |
