A3948412
Ethylene glycol-bis(2-aminoethylether) -N,N,N′,N′-tetraacetic acid , AR,99% , 67-42-5
Synonym(s):
EGTA;Glycol ether diamine tetraacetic acid;Egtazic acid;Ethylene Glycol bis (2-aminoethyl ether)-N,N,N′,N′-tetraacetic acid;Ethylene-bis(oxyethylenenitrilo)tetraacetic acid
CAS NO.:67-42-5
Empirical Formula: C14H24N2O10
Molecular Weight: 380.35
MDL number: MFCD00004291
EINECS: 200-651-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB203.20 | In Stock |
|
| 500G | RMB812.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241 °C (dec.)(lit.) |
| Boiling point: | 507.99°C (rough estimate) |
| Density | 1.2838 (rough estimate) |
| bulk density | 450kg/m3 |
| refractive index | 1.4590 (estimate) |
| storage temp. | room temp |
| solubility | 0.1 M NaOH: 0.1 M at 20 °C, clear, colorless |
| form | Crystalline Powder |
| pka | 1.47±0.10(Predicted) |
| color | White |
| biological source | synthetic (organic) |
| Water Solubility | slightly soluble |
| Merck | 14,3529 |
| BRN | 1717370 |
| InChI | 1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CCOCCOCCN(CC(O)=O)CC(O)=O)CC(O)=O |
| CAS DataBase Reference | 67-42-5(CAS DataBase Reference) |
| EPA Substance Registry System | Ethylenebis(oxyethylenenitrilo)tetraacetic acid (67-42-5) |
| Absorption | cut-off at 263nm in 1 M NaOH at 0.1M |
Description and Uses
A chelating agent useful for the determination of calcium in the presence of magnesium.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 2 |
| RTECS | AH3760000 |
| TSCA | TSCA listed |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 3587 mg/kg |





