A3955112
4-Ethynyltoluene , 98% , 766-97-2
Synonym(s):
1-Ethynyl-4-methylbenzene
CAS NO.:766-97-2
Empirical Formula: C9H8
Molecular Weight: 116.16
MDL number: MFCD00008571
EINECS: 616-371-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB455.20 | In Stock |
|
| 100G | RMB1708.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170 |
| Boiling point: | 168-170 °C(lit.) |
| Density | 0.916 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 120 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | Liquid |
| color | Clear pale yellow |
| Specific Gravity | 0.916 |
| Water Solubility | Insoluble in water. |
| BRN | 969653 |
| InChI | InChI=1S/C9H8/c1-3-9-6-4-8(2)5-7-9/h1,4-7H,2H3 |
| InChIKey | KSZVOXHGCKKOLL-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC=C(C)C=C1 |
| CAS DataBase Reference | 766-97-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-ethynyl-4-methyl-(766-97-2) |
Description and Uses
4-Ethynyltoluene was used in the synthesis of bis(bicyclic) products by the cycloaddition of alkynes to the AlN2C2.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-27-36/37/39 |
| RIDADR | UN 3295 3/PG 3 |
| WGK Germany | 3 |
| RTECS | XT2570000 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29029090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








