A3955812
Emodin , Analysis of standard products, ≥96.0%(HPLC) , 518-82-1
Synonym(s):
Emodin;Archin;Rheum emodin;Emodol;Frangula-emodin
CAS NO.:518-82-1
Empirical Formula: C15H10O5
Molecular Weight: 270.24
MDL number: MFCD00001207
EINECS: 208-258-8
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB65.60 | In Stock |
|
| 50mg | RMB114.40 | In Stock |
|
| 100mg | RMB191.20 | In Stock |
|
| 1g | RMB1216.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255 °C (dec.)(lit.) |
| Boiling point: | 373.35°C (rough estimate) |
| Density | 1.3280 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| pka | 6.39±0.20(Predicted) |
| form | powder |
| color | orange |
| biological source | Frangula bark |
| Water Solubility | <0.1 g/100 mL at 19 ºC |
| Merck | 14,3561 |
| BRN | 1888141 |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3 |
| InChIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2C(=O)c3c(O)cc(O)cc3C(=O)c2c1 |
| LogP | 3.641 (est) |
| CAS DataBase Reference | 518-82-1(CAS DataBase Reference) |
| EPA Substance Registry System | Emodin (518-82-1) |
Description and Uses
antibacterial, antineoplastic, cathartic, tyrosine kinase inhibitor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-36/37 |
| WGK Germany | 3 |
| RTECS | CB7920600 |
| F | 8-10-23 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 518-82-1(Hazardous Substances Data) |





