A4759212
1-Hydroxyanthraquinone , ≥95.0% , 129-43-1
CAS NO.:129-43-1
Empirical Formula: C14H8O3
Molecular Weight: 224.21
MDL number: MFCD00058946
EINECS: 204-946-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB143.20 | In Stock |
|
| 25G | RMB547.20 | In Stock |
|
| 100g | RMB2063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194°C |
| Boiling point: | 325.61°C (rough estimate) |
| Density | 1.2337 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform: 30 mg/ml |
| form | powder to crystal |
| pka | 7.15±0.20(Predicted) |
| color | Light yellow to Brown |
| InChI | 1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
| InChIKey | BTLXPCBPYBNQNR-UHFFFAOYSA-N |
| SMILES | Oc1cccc2C(=O)c3ccccc3C(=O)c12 |
| CAS DataBase Reference | 129-43-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 9,10-Anthracenedione, 1-hydroxy-(129-43-1) |
| IARC | 2B (Vol. 82) 2002 |
| EPA Substance Registry System | 9,10-Anthracenedione, 1-hydroxy- (129-43-1) |
Description and Uses
1-Hydroxyanthraquinone, a naturally occurring compound with oral activity from some plants like Tabebuia avellanedae, exhibits carcinogenic effect[1].
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H320-H351 |
| Precautionary statements | P501-P202-P201-P264-P280-P308+P313-P337+P313-P305+P351+P338-P405 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40-36 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | WGK 3 |
| RTECS | CB7178000 |
| TSCA | TSCA listed |
| HS Code | 2914.69.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 |
| Hazardous Substances Data | 129-43-1(Hazardous Substances Data) |




