Ethyl oleate , 75.0%(GC) , 111-62-6
Synonym(s):
Ethylis oleas;Ethyloleate;Oleic acid ethyl ester
CAS NO.:111-62-6
Empirical Formula: C20H38O2
Molecular Weight: 310.51
MDL number: MFCD00009579
EINECS: 203-889-5
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB41.60 | In Stock |
|
| 25ml | RMB140.00 | In Stock |
|
| 500ML | RMB148.00 | In Stock |
|
| 2.5L | RMB545.60 | In Stock |
|
| 10L | RMB1913.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | −32 °C(lit.) |
| Boiling point: | 216-218 °C15 mm Hg |
| Density | 0.87 g/mL at 25 °C(lit.) |
| refractive index | n |
| FEMA | 2450 | ETHYL OLEATE |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| solubility | chloroform: soluble10% |
| form | Oily Liquid |
| color | Clear |
| Odor | at 100.00 %. fatty oily dairy milky waxy tallow |
| Odor Type | fatty |
| biological source | palm oil |
| Sensitive | Light Sensitive |
| Merck | 14,6828 |
| JECFA Number | 345 |
| BRN | 1727318 |
| Dielectric constant | 3.2(28℃) |
| Cosmetics Ingredients Functions | PERFUMING SKIN CONDITIONING - EMOLLIENT |
| InChI | 1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11- |
| InChIKey | LVGKNOAMLMIIKO-VAWYXSNFSA-N |
| SMILES | CCCCCCCC\C=C/CCCCCCCC(=O)OCC |
| LogP | 8.69 |
| CAS DataBase Reference | 111-62-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 9-Octadecenoic acid (Z)-, ethyl ester(111-62-6) |
| EPA Substance Registry System | Ethyl oleate (111-62-6) |
| CAS Number Unlabeled | 111-62-6 |
Description and Uses
Ethyl oleate is a fatty acid ester formed by the condensation of oleic acid and ethanol. It is a colorless to light yellow liquid. Ethyl oleate is produced by the body during ethanol intoxication.
Ethyl oleate is used as a solvent for pharmaceutical drug preparations involving lipophilic substances such as steroids. It also finds use as a lubricant and a plasticizer. The Food and Drug Administration regulates its use as a food additive under "Food Additives Permitted for Direct Addition to Food for Human Consumption", 21CFR172.515.
Ethyl oleate is a flavoring and fragrance agent. Usually used to prepare the oily phase of self-microemulsifying drug delivery system (SMEDDS) for tacrolimus (Tac). It was obtained by the hydrolysis of various animal and vegetable fats and oils.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25-22 |
| WGK Germany | 2 |
| RTECS | RG3715000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | rabbit,LD50,skin,> 5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 20, Pg. 683, 1982. |






